About 2-methyl-8-[4-(2-methyl-1H-imidazol-5-yl)phenyl]-3H-[1]benzothiolo[2,3-e]benzimidazole
2-methyl-8-[4-(2-methyl-1H-imidazol-5-yl)phenyl]-3H-[1]benzothiolo[2,3-e]benzimidazole (PubChem CID 118569086) has the molecular formula C24H18N4S
and a molecular weight of 394.50 g/mol. Its IUPAC name is 2-methyl-8-[4-(2-methyl-1H-imidazol-5-yl)phenyl]-3H-[1]benzothiolo[2,3-e]benzimidazole.
Molecular Properties
| Compound Name | 2-methyl-8-[4-(2-methyl-1H-imidazol-5-yl)phenyl]-3H-[1]benzothiolo[2,3-e]benzimidazole |
| PubChem CID | 118569086 |
| Molecular Formula | C24H18N4S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 2-methyl-8-[4-(2-methyl-1H-imidazol-5-yl)phenyl]-3H-[1]benzothiolo[2,3-e]benzimidazole |
| SMILES | Cc1ncc(-c2ccc(-c3ccc4c(c3)sc3c4ccc4[nH]c(C)nc43)cc2)[nH]1 |
| InChI | InChI=1S/C24H18N4S/c1-13-25-12-21(26-13)16-5-3-15(4-6-16)17-7-8-18-19-9-10-20-23(28-14(2)27-20)24(19)29-22(18)11-17/h3-12H,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | OVNNSJHQCXZMAF-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-8-[4-(2-methyl-1H-imidazol-5-yl)phenyl]-3H-[1]benzothiolo[2,3-e]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-8-[4-(2-methyl-1H-imidazol-5-yl)phenyl]-3H-[1]benzothiolo[2,3-e]benzimidazole?
The IUPAC name of 2-methyl-8-[4-(2-methyl-1H-imidazol-5-yl)phenyl]-3H-[1]benzothiolo[2,3-e]benzimidazole (CID 118569086) is 2-methyl-8-[4-(2-methyl-1H-imidazol-5-yl)phenyl]-3H-[1]benzothiolo[2,3-e]benzimidazole.
What is the SMILES notation for 2-methyl-8-[4-(2-methyl-1H-imidazol-5-yl)phenyl]-3H-[1]benzothiolo[2,3-e]benzimidazole?
The canonical SMILES for 2-methyl-8-[4-(2-methyl-1H-imidazol-5-yl)phenyl]-3H-[1]benzothiolo[2,3-e]benzimidazole is Cc1ncc(-c2ccc(-c3ccc4c(c3)sc3c4ccc4[nH]c(C)nc43)cc2)[nH]1.
What is the InChIKey of 2-methyl-8-[4-(2-methyl-1H-imidazol-5-yl)phenyl]-3H-[1]benzothiolo[2,3-e]benzimidazole?
The InChIKey is OVNNSJHQCXZMAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18N4S/c1-13-25-12-21(26-13)16-5-3-15(4-6-16)17-7-8-18-19-9-10-20-23(28-14(2)27-20)24(19)29-22(18)11-17/h3-12H,1-2H3,(H,25,26)(H,27,28).
What are the key properties of 2-methyl-8-[4-(2-methyl-1H-imidazol-5-yl)phenyl]-3H-[1]benzothiolo[2,3-e]benzimidazole?
2-methyl-8-[4-(2-methyl-1H-imidazol-5-yl)phenyl]-3H-[1]benzothiolo[2,3-e]benzimidazole has a molecular weight of 394.50 g/mol, XLogP of 6.60, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-8-[4-(2-methyl-1H-imidazol-5-yl)phenyl]-3H-[1]benzothiolo[2,3-e]benzimidazole is sourced from PubChem (CID 118569086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).