C30H20N4S — CID 118569424
2-methyl-7-(2-methyl-3H-phenanthro[9,10-d]imidazol-6-yl)-3H-[1]benzothiolo[2,3-f]benzimidazole (PubChem CID 118569424) has the molecular formula C30H20N4S and a molecular weight of 468.59 g/mol. Its IUPAC name is 2-methyl-7-(2-methyl-3H-phenanthro[9,10-d]imidazol-6-yl)-3H-[1]benzothiolo[2,3-f]benzimidazole.
| Compound Name | 2-methyl-7-(2-methyl-3H-phenanthro[9,10-d]imidazol-6-yl)-3H-[1]benzothiolo[2,3-f]benzimidazole |
|---|---|
| PubChem CID | 118569424 |
| Molecular Formula | C30H20N4S |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 2-methyl-7-(2-methyl-3H-phenanthro[9,10-d]imidazol-6-yl)-3H-[1]benzothiolo[2,3-f]benzimidazole |
| SMILES | Cc1nc2cc3sc4cc(-c5ccc6c(c5)c5ccccc5c5nc(C)[nH]c65)ccc4c3cc2[nH]1 |
| InChI | InChI=1S/C30H20N4S/c1-15-31-25-13-24-20-9-7-18(12-27(20)35-28(24)14-26(25)32-15)17-8-10-22-23(11-17)19-5-3-4-6-21(19)29-30(22)34-16(2)33-29/h3-14H,1-2H3,(H,31,32)(H,33,34) |
| InChIKey | LCAOTFUSJBLXIC-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|