C9H17N3O4 — CID 134270755
methyl 3-[2-formamidoethyl(2-nitrosoethyl)amino]propanoate (PubChem CID 134270755) has the molecular formula C9H17N3O4 and a molecular weight of 231.25 g/mol. Its IUPAC name is methyl 3-[2-formamidoethyl(2-nitrosoethyl)amino]propanoate.
| Compound Name | methyl 3-[2-formamidoethyl(2-nitrosoethyl)amino]propanoate |
|---|---|
| PubChem CID | 134270755 |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | methyl 3-[2-formamidoethyl(2-nitrosoethyl)amino]propanoate |
| SMILES | COC(=O)CCN(CCN=O)CCNC=O |
| InChI | InChI=1S/C9H17N3O4/c1-16-9(14)2-5-12(7-4-11-15)6-3-10-8-13/h8H,2-7H2,1H3,(H,10,13) |
| InChIKey | AJCJAMFKOBHGDX-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|