C15H24O3 — CID 134271034
4-(1,4-dioxaspiro[4.6]undecan-8-yl)cyclohexan-1-one (PubChem CID 134271034) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 4-(1,4-dioxaspiro[4.6]undecan-8-yl)cyclohexan-1-one.
| Compound Name | 4-(1,4-dioxaspiro[4.6]undecan-8-yl)cyclohexan-1-one |
|---|---|
| PubChem CID | 134271034 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 4-(1,4-dioxaspiro[4.6]undecan-8-yl)cyclohexan-1-one |
| SMILES | O=C1CCC(C2CCCC3(CC2)OCCO3)CC1 |
| InChI | InChI=1S/C15H24O3/c16-14-5-3-13(4-6-14)12-2-1-8-15(9-7-12)17-10-11-18-15/h12-13H,1-11H2 |
| InChIKey | ZHRMQWPHXDLICS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |