C16H19F6N5O3 — CID 134276010
[(4S,5S)-5-ethyl-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]piperidin-2-yl] 2,2,2-trifluoroacetate (PubChem CID 134276010) has the molecular formula C16H19F6N5O3 and a molecular weight of 443.35 g/mol. Its IUPAC name is [(4S,5S)-5-ethyl-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]piperidin-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(4S,5S)-5-ethyl-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]piperidin-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 134276010 |
| Molecular Formula | C16H19F6N5O3 |
| Molecular Weight | 443.35 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | [(4S,5S)-5-ethyl-4-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carbonyl]piperidin-2-yl] 2,2,2-trifluoroacetate |
| SMILES | CC[C@@H]1CNC(OC(=O)C(F)(F)F)C[C@@H]1C(=O)N1CCn2c(nnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C16H19F6N5O3/c1-2-8-6-23-11(30-14(29)16(20,21)22)5-9(8)12(28)26-3-4-27-10(7-26)24-25-13(27)15(17,18)19/h8-9,11,23H,2-7H2,1H3/t8-,9+,11?/m1/s1 |
| InChIKey | YAJPNEDOFVBFNQ-VFXVZZSQSA-N |
| XLogP | 1.71 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |