C12H18O3 — CID 13427657
(E)-7-(5-hydroxycyclopent-2-en-1-yl)hept-5-enoic acid (PubChem CID 13427657) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is (E)-7-(5-hydroxycyclopent-2-en-1-yl)hept-5-enoic acid.
| Compound Name | (E)-7-(5-hydroxycyclopent-2-en-1-yl)hept-5-enoic acid |
|---|---|
| PubChem CID | 13427657 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | (E)-7-(5-hydroxycyclopent-2-en-1-yl)hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C/CC1C=CCC1O |
| InChI | InChI=1S/C12H18O3/c13-11-8-5-7-10(11)6-3-1-2-4-9-12(14)15/h1,3,5,7,10-11,13H,2,4,6,8-9H2,(H,14,15)/b3-1+ |
| InChIKey | OIAIKILNADYWHA-HNQUOIGGSA-N |
| XLogP | 2.12 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|