C20H32O4 — CID 70562700
(Z)-7-[(1S,2R)-2-(4-ethoxy-3-hydroxy-4-methylpent-1-enyl)cyclopent-3-en-1-yl]hept-5-enoic acid (PubChem CID 70562700) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (Z)-7-[(1S,2R)-2-(4-ethoxy-3-hydroxy-4-methylpent-1-enyl)cyclopent-3-en-1-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,2R)-2-(4-ethoxy-3-hydroxy-4-methylpent-1-enyl)cyclopent-3-en-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70562700 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (Z)-7-[(1S,2R)-2-(4-ethoxy-3-hydroxy-4-methylpent-1-enyl)cyclopent-3-en-1-yl]hept-5-enoic acid |
| SMILES | CCOC(C)(C)C(O)C=C[C@H]1C=CC[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H32O4/c1-4-24-20(2,3)18(21)15-14-17-12-9-11-16(17)10-7-5-6-8-13-19(22)23/h5,7,9,12,14-18,21H,4,6,8,10-11,13H2,1-3H3,(H,22,23)/b7-5-,15-14?/t16-,17+,18?/m0/s1 |
| InChIKey | FVTNURRXIVNTSU-RJLDFIAUSA-N |
| XLogP | 4.11 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|