C18H12ClF3N3O2+ — CID 134278128
3-[3-[2-chloro-5-(trifluoromethyl)phenyl]-2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-1-ium-1-yl]propanenitrile (PubChem CID 134278128) has the molecular formula C18H12ClF3N3O2+ and a molecular weight of 394.76 g/mol. Its IUPAC name is 3-[3-[2-chloro-5-(trifluoromethyl)phenyl]-2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-1-ium-1-yl]propanenitrile.
| Compound Name | 3-[3-[2-chloro-5-(trifluoromethyl)phenyl]-2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-1-ium-1-yl]propanenitrile |
|---|---|
| PubChem CID | 134278128 |
| Molecular Formula | C18H12ClF3N3O2+ |
| Molecular Weight | 394.76 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 3-[3-[2-chloro-5-(trifluoromethyl)phenyl]-2-hydroxy-4-oxopyrido[1,2-a]pyrimidin-1-ium-1-yl]propanenitrile |
| SMILES | N#CCC[n+]1c(O)c(-c2cc(C(F)(F)F)ccc2Cl)c(=O)n2ccccc21 |
| InChI | InChI=1S/C18H11ClF3N3O2/c19-13-6-5-11(18(20,21)22)10-12(13)15-16(26)24-8-2-1-4-14(24)25(17(15)27)9-3-7-23/h1-2,4-6,8,10H,3,9H2/p+1 |
| InChIKey | JOXNUFIOEUROSU-UHFFFAOYSA-O |
| XLogP | 3.55 |
| TPSA | 69.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.76 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|