C24H18ClF3N3O2+ — CID 139367258
1-[(3Z)-3-(4-chlorophenoxy)iminopropyl]-3-[3-(trifluoromethyl)phenyl]pyrido[1,2-a]pyrimidin-1-ium-4-one (PubChem CID 139367258) has the molecular formula C24H18ClF3N3O2+ and a molecular weight of 472.87 g/mol. Its IUPAC name is 1-[(3Z)-3-(4-chlorophenoxy)iminopropyl]-3-[3-(trifluoromethyl)phenyl]pyrido[1,2-a]pyrimidin-1-ium-4-one.
| Compound Name | 1-[(3Z)-3-(4-chlorophenoxy)iminopropyl]-3-[3-(trifluoromethyl)phenyl]pyrido[1,2-a]pyrimidin-1-ium-4-one |
|---|---|
| PubChem CID | 139367258 |
| Molecular Formula | C24H18ClF3N3O2+ |
| Molecular Weight | 472.87 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | 1-[(3Z)-3-(4-chlorophenoxy)iminopropyl]-3-[3-(trifluoromethyl)phenyl]pyrido[1,2-a]pyrimidin-1-ium-4-one |
| SMILES | O=c1c(-c2cccc(C(F)(F)F)c2)c[n+](CC/C=N\Oc2ccc(Cl)cc2)c2ccccn12 |
| InChI | InChI=1S/C24H18ClF3N3O2/c25-19-8-10-20(11-9-19)33-29-12-4-13-30-16-21(23(32)31-14-2-1-7-22(30)31)17-5-3-6-18(15-17)24(26,27)28/h1-3,5-12,14-16H,4,13H2/q+1/b29-12- |
| InChIKey | JFMWBXXCSKVCLX-ULPWCQAASA-N |
| XLogP | 5.38 |
| TPSA | 46.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.87 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|