C25H18F6N3O2+ — CID 139367303
1-[(3Z)-3-[3-(trifluoromethyl)phenoxy]iminopropyl]-3-[3-(trifluoromethyl)phenyl]pyrido[1,2-a]pyrimidin-1-ium-4-one (PubChem CID 139367303) has the molecular formula C25H18F6N3O2+ and a molecular weight of 506.43 g/mol. Its IUPAC name is 1-[(3Z)-3-[3-(trifluoromethyl)phenoxy]iminopropyl]-3-[3-(trifluoromethyl)phenyl]pyrido[1,2-a]pyrimidin-1-ium-4-one.
| Compound Name | 1-[(3Z)-3-[3-(trifluoromethyl)phenoxy]iminopropyl]-3-[3-(trifluoromethyl)phenyl]pyrido[1,2-a]pyrimidin-1-ium-4-one |
|---|---|
| PubChem CID | 139367303 |
| Molecular Formula | C25H18F6N3O2+ |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | 1-[(3Z)-3-[3-(trifluoromethyl)phenoxy]iminopropyl]-3-[3-(trifluoromethyl)phenyl]pyrido[1,2-a]pyrimidin-1-ium-4-one |
| SMILES | O=c1c(-c2cccc(C(F)(F)F)c2)c[n+](CC/C=N\Oc2cccc(C(F)(F)F)c2)c2ccccn12 |
| InChI | InChI=1S/C25H18F6N3O2/c26-24(27,28)18-7-3-6-17(14-18)21-16-33(22-10-1-2-13-34(22)23(21)35)12-5-11-32-36-20-9-4-8-19(15-20)25(29,30)31/h1-4,6-11,13-16H,5,12H2/q+1/b32-11- |
| InChIKey | FVUCSIZPUAOJBP-MDVINBTASA-N |
| XLogP | 5.75 |
| TPSA | 46.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|