C17H13ClN4O2 — CID 162514952
3-[(2-chlorophenyl)carbamoyl]-1-(2-cyanoethyl)imidazo[1,2-a]pyridin-1-ium-2-olate (PubChem CID 162514952) has the molecular formula C17H13ClN4O2 and a molecular weight of 340.77 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)carbamoyl]-1-(2-cyanoethyl)imidazo[1,2-a]pyridin-1-ium-2-olate.
| Compound Name | 3-[(2-chlorophenyl)carbamoyl]-1-(2-cyanoethyl)imidazo[1,2-a]pyridin-1-ium-2-olate |
|---|---|
| PubChem CID | 162514952 |
| Molecular Formula | C17H13ClN4O2 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 3-[(2-chlorophenyl)carbamoyl]-1-(2-cyanoethyl)imidazo[1,2-a]pyridin-1-ium-2-olate |
| SMILES | N#CCC[n+]1c([O-])c(C(=O)Nc2ccccc2Cl)n2ccccc21 |
| InChI | InChI=1S/C17H13ClN4O2/c18-12-6-1-2-7-13(12)20-16(23)15-17(24)22(11-5-9-19)14-8-3-4-10-21(14)15/h1-4,6-8,10H,5,11H2,(H-,20,23,24) |
| InChIKey | RFFXEURSODFICT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|