C16H13BrN5O2+ — CID 162514933
N-(4-bromo-2-pyridinyl)-1-(2-cyanoethyl)-2-hydroxyimidazo[1,2-a]pyridin-1-ium-3-carboxamide (PubChem CID 162514933) has the molecular formula C16H13BrN5O2+ and a molecular weight of 387.22 g/mol. Its IUPAC name is N-(4-bromo-2-pyridinyl)-1-(2-cyanoethyl)-2-hydroxyimidazo[1,2-a]pyridin-1-ium-3-carboxamide.
| Compound Name | N-(4-bromo-2-pyridinyl)-1-(2-cyanoethyl)-2-hydroxyimidazo[1,2-a]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 162514933 |
| Molecular Formula | C16H13BrN5O2+ |
| Molecular Weight | 387.22 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | N-(4-bromo-2-pyridinyl)-1-(2-cyanoethyl)-2-hydroxyimidazo[1,2-a]pyridin-1-ium-3-carboxamide |
| SMILES | N#CCC[n+]1c(O)c(C(=O)Nc2cc(Br)ccn2)n2ccccc21 |
| InChI | InChI=1S/C16H12BrN5O2/c17-11-5-7-19-12(10-11)20-15(23)14-16(24)22(9-3-6-18)13-4-1-2-8-21(13)14/h1-2,4-5,7-8,10H,3,9H2,(H-,19,20,23,24)/p+1 |
| InChIKey | GPFJYOXGYPBTFZ-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.22 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|