C18H13FN6O2 — CID 162514986
3-[(4-fluoro-2-pyridinyl)carbamoyl]-1-(pyrimidin-5-ylmethyl)imidazo[1,2-a]pyridin-1-ium-2-olate (PubChem CID 162514986) has the molecular formula C18H13FN6O2 and a molecular weight of 364.34 g/mol. Its IUPAC name is 3-[(4-fluoro-2-pyridinyl)carbamoyl]-1-(pyrimidin-5-ylmethyl)imidazo[1,2-a]pyridin-1-ium-2-olate.
| Compound Name | 3-[(4-fluoro-2-pyridinyl)carbamoyl]-1-(pyrimidin-5-ylmethyl)imidazo[1,2-a]pyridin-1-ium-2-olate |
|---|---|
| PubChem CID | 162514986 |
| Molecular Formula | C18H13FN6O2 |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 3-[(4-fluoro-2-pyridinyl)carbamoyl]-1-(pyrimidin-5-ylmethyl)imidazo[1,2-a]pyridin-1-ium-2-olate |
| SMILES | O=C(Nc1cc(F)ccn1)c1c([O-])[n+](Cc2cncnc2)c2ccccn12 |
| InChI | InChI=1S/C18H13FN6O2/c19-13-4-5-22-14(7-13)23-17(26)16-18(27)25(10-12-8-20-11-21-9-12)15-3-1-2-6-24(15)16/h1-9,11H,10H2,(H-,22,23,26,27) |
| InChIKey | BJFUUQCBGVKZHB-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|