C26H25ClN6O3 — CID 134282911
N-[4-[[5-(2-chloro-6-phenoxypyridine-3-carbonyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]acetamide (PubChem CID 134282911) has the molecular formula C26H25ClN6O3 and a molecular weight of 504.98 g/mol. Its IUPAC name is N-[4-[[5-(2-chloro-6-phenoxypyridine-3-carbonyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]acetamide.
| Compound Name | N-[4-[[5-(2-chloro-6-phenoxypyridine-3-carbonyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 134282911 |
| Molecular Formula | C26H25ClN6O3 |
| Molecular Weight | 504.98 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | N-[4-[[5-(2-chloro-6-phenoxypyridine-3-carbonyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]acetamide |
| SMILES | CC(=O)NC1CCC(Nc2ncnc3[nH]cc(C(=O)c4ccc(Oc5ccccc5)nc4Cl)c23)CC1 |
| InChI | InChI=1S/C26H25ClN6O3/c1-15(34)31-16-7-9-17(10-8-16)32-26-22-20(13-28-25(22)29-14-30-26)23(35)19-11-12-21(33-24(19)27)36-18-5-3-2-4-6-18/h2-6,11-14,16-17H,7-10H2,1H3,(H,31,34)(H2,28,29,30,32) |
| InChIKey | PAEGLKBZZDXPHK-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 121.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.98 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|