C31H33BClN5O3 — CID 164865493
CID 164865493 (PubChem CID 164865493) has the molecular formula C31H33BClN5O3 and a molecular weight of 569.90 g/mol.
| Compound Name | CID 164865493 |
|---|---|
| PubChem CID | 164865493 |
| Molecular Formula | C31H33BClN5O3 |
| Molecular Weight | 569.90 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | — |
| SMILES | [B]CCCCCCC(=O)N1CCC(Nc2ncnc3[nH]cc(C(=O)c4ccc(Oc5ccccc5)cc4Cl)c23)CC1 |
| InChI | InChI=1S/C31H33BClN5O3/c32-15-7-2-1-6-10-27(39)38-16-13-21(14-17-38)37-31-28-25(19-34-30(28)35-20-36-31)29(40)24-12-11-23(18-26(24)33)41-22-8-4-3-5-9-22/h3-5,8-9,11-12,18-21H,1-2,6-7,10,13-17H2,(H2,34,35,36,37) |
| InChIKey | KSUHTIXVIGFEAH-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.90 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|