C25H21ClFN5O3 — CID 134283232
2-chloro-1-[3-[[5-(2-fluoro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]ethanone (PubChem CID 134283232) has the molecular formula C25H21ClFN5O3 and a molecular weight of 493.93 g/mol. Its IUPAC name is 2-chloro-1-[3-[[5-(2-fluoro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]ethanone.
| Compound Name | 2-chloro-1-[3-[[5-(2-fluoro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 134283232 |
| Molecular Formula | C25H21ClFN5O3 |
| Molecular Weight | 493.93 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 2-chloro-1-[3-[[5-(2-fluoro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]ethanone |
| SMILES | O=C(c1ccc(Oc2ccccc2)cc1F)c1c[nH]c2ncnc(NC3CCN(C(=O)CCl)C3)c12 |
| InChI | InChI=1S/C25H21ClFN5O3/c26-11-21(33)32-9-8-15(13-32)31-25-22-19(12-28-24(22)29-14-30-25)23(34)18-7-6-17(10-20(18)27)35-16-4-2-1-3-5-16/h1-7,10,12,14-15H,8-9,11,13H2,(H2,28,29,30,31) |
| InChIKey | OYJNBQIQTJGRSB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.93 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|