C27H21ClN6O3 — CID 134283257
2-[3-[[5-(2-chloro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidine-1-carbonyl]prop-2-enenitrile (PubChem CID 134283257) has the molecular formula C27H21ClN6O3 and a molecular weight of 512.96 g/mol. Its IUPAC name is 2-[3-[[5-(2-chloro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidine-1-carbonyl]prop-2-enenitrile.
| Compound Name | 2-[3-[[5-(2-chloro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidine-1-carbonyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 134283257 |
| Molecular Formula | C27H21ClN6O3 |
| Molecular Weight | 512.96 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | 2-[3-[[5-(2-chloro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidine-1-carbonyl]prop-2-enenitrile |
| SMILES | C=C(C#N)C(=O)N1CCC(Nc2ncnc3[nH]cc(C(=O)c4ccc(Oc5ccccc5)cc4Cl)c23)C1 |
| InChI | InChI=1S/C27H21ClN6O3/c1-16(12-29)27(36)34-10-9-17(14-34)33-26-23-21(13-30-25(23)31-15-32-26)24(35)20-8-7-19(11-22(20)28)37-18-5-3-2-4-6-18/h2-8,11,13,15,17H,1,9-10,14H2,(H2,30,31,32,33) |
| InChIKey | UXXWUSWBTOYZLS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 124.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.96 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|