C28H23FN6O3 — CID 134282851
(E)-2-[3-[[5-(2-fluoro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidine-1-carbonyl]but-2-enenitrile (PubChem CID 134282851) has the molecular formula C28H23FN6O3 and a molecular weight of 510.53 g/mol. Its IUPAC name is (E)-2-[3-[[5-(2-fluoro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidine-1-carbonyl]but-2-enenitrile.
| Compound Name | (E)-2-[3-[[5-(2-fluoro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidine-1-carbonyl]but-2-enenitrile |
|---|---|
| PubChem CID | 134282851 |
| Molecular Formula | C28H23FN6O3 |
| Molecular Weight | 510.53 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | (E)-2-[3-[[5-(2-fluoro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidine-1-carbonyl]but-2-enenitrile |
| SMILES | C/C=C(\C#N)C(=O)N1CCC(Nc2ncnc3[nH]cc(C(=O)c4ccc(Oc5ccccc5)cc4F)c23)C1 |
| InChI | InChI=1S/C28H23FN6O3/c1-2-17(13-30)28(37)35-11-10-18(15-35)34-27-24-22(14-31-26(24)32-16-33-27)25(36)21-9-8-20(12-23(21)29)38-19-6-4-3-5-7-19/h2-9,12,14,16,18H,10-11,15H2,1H3,(H2,31,32,33,34)/b17-2+ |
| InChIKey | NDZCWFWXLFGDBP-LAZPYJJCSA-N |
| XLogP | 4.60 |
| TPSA | 124.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|