C28H25N5O6 — CID 134283040
methyl 3-[3-[[5-(4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidine-1-carbonyl]oxirane-2-carboxylate (PubChem CID 134283040) has the molecular formula C28H25N5O6 and a molecular weight of 527.54 g/mol. Its IUPAC name is methyl 3-[3-[[5-(4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidine-1-carbonyl]oxirane-2-carboxylate.
| Compound Name | methyl 3-[3-[[5-(4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidine-1-carbonyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 134283040 |
| Molecular Formula | C28H25N5O6 |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | methyl 3-[3-[[5-(4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidine-1-carbonyl]oxirane-2-carboxylate |
| SMILES | COC(=O)C1OC1C(=O)N1CCC(Nc2ncnc3[nH]cc(C(=O)c4ccc(Oc5ccccc5)cc4)c23)C1 |
| InChI | InChI=1S/C28H25N5O6/c1-37-28(36)24-23(39-24)27(35)33-12-11-17(14-33)32-26-21-20(13-29-25(21)30-15-31-26)22(34)16-7-9-19(10-8-16)38-18-5-3-2-4-6-18/h2-10,13,15,17,23-24H,11-12,14H2,1H3,(H2,29,30,31,32) |
| InChIKey | DLEXGKYQGFBEPI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 139.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|