C27H25N5O4 — CID 134282866
oxiran-2-yl-[2-[[[5-(4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]methyl]pyrrolidin-1-yl]methanone (PubChem CID 134282866) has the molecular formula C27H25N5O4 and a molecular weight of 483.53 g/mol. Its IUPAC name is oxiran-2-yl-[2-[[[5-(4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]methyl]pyrrolidin-1-yl]methanone.
| Compound Name | oxiran-2-yl-[2-[[[5-(4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]methyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 134282866 |
| Molecular Formula | C27H25N5O4 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | oxiran-2-yl-[2-[[[5-(4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]methyl]pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Oc2ccccc2)cc1)c1c[nH]c2ncnc(NCC3CCCN3C(=O)C3CO3)c12 |
| InChI | InChI=1S/C27H25N5O4/c33-24(17-8-10-20(11-9-17)36-19-6-2-1-3-7-19)21-14-29-26-23(21)25(30-16-31-26)28-13-18-5-4-12-32(18)27(34)22-15-35-22/h1-3,6-11,14,16,18,22H,4-5,12-13,15H2,(H2,28,29,30,31) |
| InChIKey | DUZZWKKJLDRSJM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|