C27H25ClIN5O3 — CID 134283199
1-[2-[[[5-(2-chloro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]methyl]piperidin-1-yl]-2-iodoethanone (PubChem CID 134283199) has the molecular formula C27H25ClIN5O3 and a molecular weight of 629.89 g/mol. Its IUPAC name is 1-[2-[[[5-(2-chloro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]methyl]piperidin-1-yl]-2-iodoethanone.
| Compound Name | 1-[2-[[[5-(2-chloro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]methyl]piperidin-1-yl]-2-iodoethanone |
|---|---|
| PubChem CID | 134283199 |
| Molecular Formula | C27H25ClIN5O3 |
| Molecular Weight | 629.89 g/mol |
| Exact Mass | 629.07 |
| IUPAC Name | 1-[2-[[[5-(2-chloro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]methyl]piperidin-1-yl]-2-iodoethanone |
| SMILES | O=C(c1ccc(Oc2ccccc2)cc1Cl)c1c[nH]c2ncnc(NCC3CCCCN3C(=O)CI)c12 |
| InChI | InChI=1S/C27H25ClIN5O3/c28-22-12-19(37-18-7-2-1-3-8-18)9-10-20(22)25(36)21-15-31-27-24(21)26(32-16-33-27)30-14-17-6-4-5-11-34(17)23(35)13-29/h1-3,7-10,12,15-17H,4-6,11,13-14H2,(H2,30,31,32,33) |
| InChIKey | APLQVSQLVWPDFM-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.89 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|