C29H28ClN5O4 — CID 134283094
[3-[[5-(2-chloro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]azepan-1-yl]-(3-methyloxiran-2-yl)methanone (PubChem CID 134283094) has the molecular formula C29H28ClN5O4 and a molecular weight of 546.03 g/mol. Its IUPAC name is [3-[[5-(2-chloro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]azepan-1-yl]-(3-methyloxiran-2-yl)methanone.
| Compound Name | [3-[[5-(2-chloro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]azepan-1-yl]-(3-methyloxiran-2-yl)methanone |
|---|---|
| PubChem CID | 134283094 |
| Molecular Formula | C29H28ClN5O4 |
| Molecular Weight | 546.03 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | [3-[[5-(2-chloro-4-phenoxybenzoyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]azepan-1-yl]-(3-methyloxiran-2-yl)methanone |
| SMILES | CC1OC1C(=O)N1CCCCC(Nc2ncnc3[nH]cc(C(=O)c4ccc(Oc5ccccc5)cc4Cl)c23)C1 |
| InChI | InChI=1S/C29H28ClN5O4/c1-17-26(38-17)29(37)35-12-6-5-7-18(15-35)34-28-24-22(14-31-27(24)32-16-33-28)25(36)21-11-10-20(13-23(21)30)39-19-8-3-2-4-9-19/h2-4,8-11,13-14,16-18,26H,5-7,12,15H2,1H3,(H2,31,32,33,34) |
| InChIKey | ZHCBIVXCTMLRDN-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.03 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|