C20H34O4 — CID 134284311
1,4-bis[(2R)-2-tert-butylperoxypropyl]benzene (PubChem CID 134284311) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is 1,4-bis[(2R)-2-tert-butylperoxypropyl]benzene.
| Compound Name | 1,4-bis[(2R)-2-tert-butylperoxypropyl]benzene |
|---|---|
| PubChem CID | 134284311 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 1,4-bis[(2R)-2-tert-butylperoxypropyl]benzene |
| SMILES | C[C@H](Cc1ccc(C[C@@H](C)OOC(C)(C)C)cc1)OOC(C)(C)C |
| InChI | InChI=1S/C20H34O4/c1-15(21-23-19(3,4)5)13-17-9-11-18(12-10-17)14-16(2)22-24-20(6,7)8/h9-12,15-16H,13-14H2,1-8H3/t15-,16-/m1/s1 |
| InChIKey | BUKZOQKPQZSQNW-HZPDHXFCSA-N |
| XLogP | 5.04 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|