C24H32O4 — CID 102271818
[(E)-1,4-bis(tert-butylperoxy)-4-phenylbut-2-enyl]benzene (PubChem CID 102271818) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is [(E)-1,4-bis(tert-butylperoxy)-4-phenylbut-2-enyl]benzene.
| Compound Name | [(E)-1,4-bis(tert-butylperoxy)-4-phenylbut-2-enyl]benzene |
|---|---|
| PubChem CID | 102271818 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | [(E)-1,4-bis(tert-butylperoxy)-4-phenylbut-2-enyl]benzene |
| SMILES | CC(C)(C)OOC(/C=C/C(OOC(C)(C)C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H32O4/c1-23(2,3)27-25-21(19-13-9-7-10-14-19)17-18-22(26-28-24(4,5)6)20-15-11-8-12-16-20/h7-18,21-22H,1-6H3/b18-17+ |
| InChIKey | DGJUYSCHHDUDES-ISLYRVAYSA-N |
| XLogP | 6.52 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|