C15H24O9 — CID 141322649
1,3,5-tris[2-(trioxidanyl)propyl]benzene (PubChem CID 141322649) has the molecular formula C15H24O9 and a molecular weight of 348.35 g/mol. Its IUPAC name is 1,3,5-tris[2-(trioxidanyl)propyl]benzene.
| Compound Name | 1,3,5-tris[2-(trioxidanyl)propyl]benzene |
|---|---|
| PubChem CID | 141322649 |
| Molecular Formula | C15H24O9 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1,3,5-tris[2-(trioxidanyl)propyl]benzene |
| SMILES | CC(Cc1cc(CC(C)OOO)cc(CC(C)OOO)c1)OOO |
| InChI | InChI=1S/C15H24O9/c1-10(19-22-16)4-13-7-14(5-11(2)20-23-17)9-15(8-13)6-12(3)21-24-18/h7-12,16-18H,4-6H2,1-3H3 |
| InChIKey | MVZRSVOOZOHJKK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|