C22H19F5N4O4 — CID 134285119
1-[2-[(1-carbamoyl-3,3-difluorocyclobutyl)amino]-2-oxoacetyl]-2-methyl-N-(3,4,5-trifluorophenyl)-6,7-dihydro-5H-pyrrolizine-3-carboxamide (PubChem CID 134285119) has the molecular formula C22H19F5N4O4 and a molecular weight of 498.41 g/mol. Its IUPAC name is 1-[2-[(1-carbamoyl-3,3-difluorocyclobutyl)amino]-2-oxoacetyl]-2-methyl-N-(3,4,5-trifluorophenyl)-6,7-dihydro-5H-pyrrolizine-3-carboxamide.
| Compound Name | 1-[2-[(1-carbamoyl-3,3-difluorocyclobutyl)amino]-2-oxoacetyl]-2-methyl-N-(3,4,5-trifluorophenyl)-6,7-dihydro-5H-pyrrolizine-3-carboxamide |
|---|---|
| PubChem CID | 134285119 |
| Molecular Formula | C22H19F5N4O4 |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 1-[2-[(1-carbamoyl-3,3-difluorocyclobutyl)amino]-2-oxoacetyl]-2-methyl-N-(3,4,5-trifluorophenyl)-6,7-dihydro-5H-pyrrolizine-3-carboxamide |
| SMILES | Cc1c(C(=O)C(=O)NC2(C(N)=O)CC(F)(F)C2)c2n(c1C(=O)Nc1cc(F)c(F)c(F)c1)CCC2 |
| InChI | InChI=1S/C22H19F5N4O4/c1-9-14(17(32)19(34)30-21(20(28)35)7-22(26,27)8-21)13-3-2-4-31(13)16(9)18(33)29-10-5-11(23)15(25)12(24)6-10/h5-6H,2-4,7-8H2,1H3,(H2,28,35)(H,29,33)(H,30,34) |
| InChIKey | WRMTULCTQIDTJD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|