C26H23IN2O3 — CID 134285525
1-[2-[(1S)-5-hydroxy-1-(2-iodoethyl)-9-methyl-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-indol-5-yl]ethanone (PubChem CID 134285525) has the molecular formula C26H23IN2O3 and a molecular weight of 538.39 g/mol. Its IUPAC name is 1-[2-[(1S)-5-hydroxy-1-(2-iodoethyl)-9-methyl-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-indol-5-yl]ethanone.
| Compound Name | 1-[2-[(1S)-5-hydroxy-1-(2-iodoethyl)-9-methyl-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-indol-5-yl]ethanone |
|---|---|
| PubChem CID | 134285525 |
| Molecular Formula | C26H23IN2O3 |
| Molecular Weight | 538.39 g/mol |
| Exact Mass | 538.08 |
| IUPAC Name | 1-[2-[(1S)-5-hydroxy-1-(2-iodoethyl)-9-methyl-1,2-dihydrobenzo[e]indole-3-carbonyl]-1H-indol-5-yl]ethanone |
| SMILES | CC(=O)c1ccc2[nH]c(C(=O)N3C[C@@H](CCI)c4c3cc(O)c3cccc(C)c43)cc2c1 |
| InChI | InChI=1S/C26H23IN2O3/c1-14-4-3-5-19-23(31)12-22-25(24(14)19)17(8-9-27)13-29(22)26(32)21-11-18-10-16(15(2)30)6-7-20(18)28-21/h3-7,10-12,17,28,31H,8-9,13H2,1-2H3/t17-/m1/s1 |
| InChIKey | HFOHIGZXOGFGDZ-QGZVFWFLSA-N |
| XLogP | 6.11 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.39 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|