C16H19F2N3 — CID 134286803
N'-[(3E,5E)-6,7-difluorohepta-1,3,5-trien-4-yl]-2-propylpyridine-3-carboximidamide (PubChem CID 134286803) has the molecular formula C16H19F2N3 and a molecular weight of 291.35 g/mol. Its IUPAC name is N'-[(3E,5E)-6,7-difluorohepta-1,3,5-trien-4-yl]-2-propylpyridine-3-carboximidamide.
| Compound Name | N'-[(3E,5E)-6,7-difluorohepta-1,3,5-trien-4-yl]-2-propylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 134286803 |
| Molecular Formula | C16H19F2N3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | N'-[(3E,5E)-6,7-difluorohepta-1,3,5-trien-4-yl]-2-propylpyridine-3-carboximidamide |
| SMILES | C=C/C=C(\C=C(\F)CF)/N=C(\N)c1cccnc1CCC |
| InChI | InChI=1S/C16H19F2N3/c1-3-6-13(10-12(18)11-17)21-16(19)14-8-5-9-20-15(14)7-4-2/h3,5-6,8-10H,1,4,7,11H2,2H3,(H2,19,21)/b12-10+,13-6+ |
| InChIKey | DHDWDJZTWJTAGX-CZKXXPGYSA-N |
| XLogP | 3.63 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|