C15H16N2O2S — CID 134287069
1,2,5-oxadiazepan-5-yl-(2-thiophen-2-ylphenyl)methanone (PubChem CID 134287069) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is 1,2,5-oxadiazepan-5-yl-(2-thiophen-2-ylphenyl)methanone.
| Compound Name | 1,2,5-oxadiazepan-5-yl-(2-thiophen-2-ylphenyl)methanone |
|---|---|
| PubChem CID | 134287069 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 1,2,5-oxadiazepan-5-yl-(2-thiophen-2-ylphenyl)methanone |
| SMILES | O=C(c1ccccc1-c1cccs1)N1CCNOCC1 |
| InChI | InChI=1S/C15H16N2O2S/c18-15(17-8-7-16-19-10-9-17)13-5-2-1-4-12(13)14-6-3-11-20-14/h1-6,11,16H,7-10H2 |
| InChIKey | JTZRBHPXFFXHEW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |