C12H16FN5 — CID 134287889
4-[(Z)-1-amino-2-[2,2-diaminoethyl(methyl)amino]ethenyl]-2-fluorobenzonitrile (PubChem CID 134287889) has the molecular formula C12H16FN5 and a molecular weight of 249.29 g/mol. Its IUPAC name is 4-[(Z)-1-amino-2-[2,2-diaminoethyl(methyl)amino]ethenyl]-2-fluorobenzonitrile.
| Compound Name | 4-[(Z)-1-amino-2-[2,2-diaminoethyl(methyl)amino]ethenyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 134287889 |
| Molecular Formula | C12H16FN5 |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 4-[(Z)-1-amino-2-[2,2-diaminoethyl(methyl)amino]ethenyl]-2-fluorobenzonitrile |
| SMILES | CN(/C=C(\N)c1ccc(C#N)c(F)c1)CC(N)N |
| InChI | InChI=1S/C12H16FN5/c1-18(7-12(16)17)6-11(15)8-2-3-9(5-14)10(13)4-8/h2-4,6,12H,7,15-17H2,1H3/b11-6- |
| InChIKey | UKJBRAWQACXCAX-WDZFZDKYSA-N |
| XLogP | 0.13 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|