C44H45Cl2F3N4O5 — CID 134289663
CID 134289663 (PubChem CID 134289663) has the molecular formula C44H45Cl2F3N4O5 and a molecular weight of 837.77 g/mol.
| Compound Name | CID 134289663 |
|---|---|
| PubChem CID | 134289663 |
| Molecular Formula | C44H45Cl2F3N4O5 |
| Molecular Weight | 837.77 g/mol |
| Exact Mass | 836.27 |
| IUPAC Name | — |
| SMILES | CC(C)(O)[C@@H]1CCC(NC(=O)[C@H]2[C@H](c3ccnc(Cl)c3F)[C@]3(C(=O)Nc4cc(Cl)ccc43)C3(CC(CF)(CF)C3)N2[C@H](c2ccccc2)[C@@H](O)c2ccccc2)CO1 |
| InChI | InChI=1S/C44H45Cl2F3N4O5/c1-41(2,57)32-16-14-28(20-58-32)51-39(55)36-33(29-17-18-50-38(46)34(29)49)44(30-15-13-27(45)19-31(30)52-40(44)56)43(21-42(22-43,23-47)24-48)53(36)35(25-9-5-3-6-10-25)37(54)26-11-7-4-8-12-26/h3-13,15,17-19,28,32-33,35-37,54,57H,14,16,20-24H2,1-2H3,(H,51,55)(H,52,56)/t28?,32-,33-,35+,36+,37-,44+/m0/s1 |
| InChIKey | AYCGHBVKEYBWBO-WBNWQFFCSA-N |
| XLogP | 7.55 |
| TPSA | 124.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.77 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|