C46H50Cl2N4O6 — CID 70871698
CID 70871698 (PubChem CID 70871698) has the molecular formula C46H50Cl2N4O6 and a molecular weight of 825.83 g/mol.
| Compound Name | CID 70871698 |
|---|---|
| PubChem CID | 70871698 |
| Molecular Formula | C46H50Cl2N4O6 |
| Molecular Weight | 825.83 g/mol |
| Exact Mass | 824.31 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC2(CC1)N([C@H](c1ccccc1)[C@@H](O)c1ccccc1)[C@@H](C(=O)NC1CCC(O)CC1)[C@H](c1cc(Cl)cc(NC(=O)O)c1)C21C(=O)Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C46H50Cl2N4O6/c1-44(2)19-21-45(22-20-44)46(35-18-13-30(47)26-36(35)51-42(46)56)37(29-23-31(48)25-33(24-29)50-43(57)58)39(41(55)49-32-14-16-34(53)17-15-32)52(45)38(27-9-5-3-6-10-27)40(54)28-11-7-4-8-12-28/h3-13,18,23-26,32,34,37-40,50,53-54H,14-17,19-22H2,1-2H3,(H,49,55)(H,51,56)(H,57,58)/t32?,34?,37-,38+,39+,40-,46?/m0/s1 |
| InChIKey | FGYSUXGHXJDKGS-JHRDIRKKSA-N |
| XLogP | 8.97 |
| TPSA | 151.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.83 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |