C10H16O2 — CID 13429331
7-ethyl-2,4-dimethyl-6,8-dioxabicyclo[3.2.1]oct-3-ene (PubChem CID 13429331) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 7-ethyl-2,4-dimethyl-6,8-dioxabicyclo[3.2.1]oct-3-ene.
| Compound Name | 7-ethyl-2,4-dimethyl-6,8-dioxabicyclo[3.2.1]oct-3-ene |
|---|---|
| PubChem CID | 13429331 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 7-ethyl-2,4-dimethyl-6,8-dioxabicyclo[3.2.1]oct-3-ene |
| SMILES | CCC1OC2OC1C(C)C=C2C |
| InChI | InChI=1S/C10H16O2/c1-4-8-9-6(2)5-7(3)10(11-8)12-9/h5-6,8-10H,4H2,1-3H3 |
| InChIKey | KEYVGBXKVKYKGT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|