C6H12N4 — CID 134294180
(2R,4R)-4-azido-2-ethylpyrrolidine (PubChem CID 134294180) has the molecular formula C6H12N4 and a molecular weight of 140.19 g/mol. Its IUPAC name is (2R,4R)-4-azido-2-ethylpyrrolidine.
| Compound Name | (2R,4R)-4-azido-2-ethylpyrrolidine |
|---|---|
| PubChem CID | 134294180 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | (2R,4R)-4-azido-2-ethylpyrrolidine |
| SMILES | CC[C@@H]1C[C@@H](N=[N+]=[N-])CN1 |
| InChI | InChI=1S/C6H12N4/c1-2-5-3-6(4-8-5)9-10-7/h5-6,8H,2-4H2,1H3/t5-,6-/m1/s1 |
| InChIKey | YVXFQBZLJNHTHS-PHDIDXHHSA-N |
| XLogP | 1.44 |
| TPSA | 60.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|