About 4-ethyl-6-methyl-1,3-diazinane
4-ethyl-6-methyl-1,3-diazinane (PubChem CID 146883415) has the molecular formula C7H16N2
and a molecular weight of 128.22 g/mol. Its IUPAC name is 4-ethyl-6-methyl-1,3-diazinane.
Molecular Properties
| Compound Name | 4-ethyl-6-methyl-1,3-diazinane |
| PubChem CID | 146883415 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | 4-ethyl-6-methyl-1,3-diazinane |
| SMILES | CCC1CC(C)NCN1 |
| InChI | InChI=1S/C7H16N2/c1-3-7-4-6(2)8-5-9-7/h6-9H,3-5H2,1-2H3 |
| InChIKey | SUOZUHBLDDLETD-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-6-methyl-1,3-diazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-6-methyl-1,3-diazinane?
The IUPAC name of 4-ethyl-6-methyl-1,3-diazinane (CID 146883415) is 4-ethyl-6-methyl-1,3-diazinane.
What is the SMILES notation for 4-ethyl-6-methyl-1,3-diazinane?
The canonical SMILES for 4-ethyl-6-methyl-1,3-diazinane is CCC1CC(C)NCN1.
What is the InChIKey of 4-ethyl-6-methyl-1,3-diazinane?
The InChIKey is SUOZUHBLDDLETD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2/c1-3-7-4-6(2)8-5-9-7/h6-9H,3-5H2,1-2H3.
What are the key properties of 4-ethyl-6-methyl-1,3-diazinane?
4-ethyl-6-methyl-1,3-diazinane has a molecular weight of 128.22 g/mol, XLogP of 0.69, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-6-methyl-1,3-diazinane is sourced from PubChem (CID 146883415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).