C18H28FN — CID 134297747
(4E,6Z)-4-fluoro-N-hept-1-en-2-yl-7-methyl-3-methylidenenona-1,4,6-trien-2-amine (PubChem CID 134297747) has the molecular formula C18H28FN and a molecular weight of 277.43 g/mol. Its IUPAC name is (4E,6Z)-4-fluoro-N-hept-1-en-2-yl-7-methyl-3-methylidenenona-1,4,6-trien-2-amine.
| Compound Name | (4E,6Z)-4-fluoro-N-hept-1-en-2-yl-7-methyl-3-methylidenenona-1,4,6-trien-2-amine |
|---|---|
| PubChem CID | 134297747 |
| Molecular Formula | C18H28FN |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | (4E,6Z)-4-fluoro-N-hept-1-en-2-yl-7-methyl-3-methylidenenona-1,4,6-trien-2-amine |
| SMILES | C=C(CCCCC)NC(=C)C(=C)/C(F)=C/C=C(/C)CC |
| InChI | InChI=1S/C18H28FN/c1-7-9-10-11-15(4)20-17(6)16(5)18(19)13-12-14(3)8-2/h12-13,20H,4-11H2,1-3H3/b14-12-,18-13+ |
| InChIKey | GBZSAAJGMJVWDM-FGFUYGETSA-N |
| XLogP | 5.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|