C11H21NO3 — CID 134299206
1,5-dihydroxy-4-methyl-3,4-di(propan-2-yl)pyrrolidin-2-one (PubChem CID 134299206) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 1,5-dihydroxy-4-methyl-3,4-di(propan-2-yl)pyrrolidin-2-one.
| Compound Name | 1,5-dihydroxy-4-methyl-3,4-di(propan-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 134299206 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 1,5-dihydroxy-4-methyl-3,4-di(propan-2-yl)pyrrolidin-2-one |
| SMILES | CC(C)C1C(=O)N(O)C(O)C1(C)C(C)C |
| InChI | InChI=1S/C11H21NO3/c1-6(2)8-9(13)12(15)10(14)11(8,5)7(3)4/h6-8,10,14-15H,1-5H3 |
| InChIKey | SUWUIVHOJWMLNH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|