C12H18ClN5O — CID 134299741
N'-(3-chloropyrazin-2-yl)-3-ethylpiperidine-1-carbohydrazide (PubChem CID 134299741) has the molecular formula C12H18ClN5O and a molecular weight of 283.76 g/mol. Its IUPAC name is N'-(3-chloropyrazin-2-yl)-3-ethylpiperidine-1-carbohydrazide.
| Compound Name | N'-(3-chloropyrazin-2-yl)-3-ethylpiperidine-1-carbohydrazide |
|---|---|
| PubChem CID | 134299741 |
| Molecular Formula | C12H18ClN5O |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | N'-(3-chloropyrazin-2-yl)-3-ethylpiperidine-1-carbohydrazide |
| SMILES | CCC1CCCN(C(=O)NNc2nccnc2Cl)C1 |
| InChI | InChI=1S/C12H18ClN5O/c1-2-9-4-3-7-18(8-9)12(19)17-16-11-10(13)14-5-6-15-11/h5-6,9H,2-4,7-8H2,1H3,(H,15,16)(H,17,19) |
| InChIKey | HCPMYDJIJVLQAW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|