C10H13ClFN5O — CID 139295693
N'-(3-chloropyrazin-2-yl)-3-fluoropiperidine-1-carbohydrazide (PubChem CID 139295693) has the molecular formula C10H13ClFN5O and a molecular weight of 273.70 g/mol. Its IUPAC name is N'-(3-chloropyrazin-2-yl)-3-fluoropiperidine-1-carbohydrazide.
| Compound Name | N'-(3-chloropyrazin-2-yl)-3-fluoropiperidine-1-carbohydrazide |
|---|---|
| PubChem CID | 139295693 |
| Molecular Formula | C10H13ClFN5O |
| Molecular Weight | 273.70 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | N'-(3-chloropyrazin-2-yl)-3-fluoropiperidine-1-carbohydrazide |
| SMILES | O=C(NNc1nccnc1Cl)N1CCCC(F)C1 |
| InChI | InChI=1S/C10H13ClFN5O/c11-8-9(14-4-3-13-8)15-16-10(18)17-5-1-2-7(12)6-17/h3-4,7H,1-2,5-6H2,(H,14,15)(H,16,18) |
| InChIKey | FEZCIIMVZNXASW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.70 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|