C23H23N3O4 — CID 134301368
7-[2-(2,4-dimethoxyanilino)-5-ethylpyrimidin-4-yl]oxy-2,3-dihydroinden-1-one (PubChem CID 134301368) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is 7-[2-(2,4-dimethoxyanilino)-5-ethylpyrimidin-4-yl]oxy-2,3-dihydroinden-1-one.
| Compound Name | 7-[2-(2,4-dimethoxyanilino)-5-ethylpyrimidin-4-yl]oxy-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 134301368 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 7-[2-(2,4-dimethoxyanilino)-5-ethylpyrimidin-4-yl]oxy-2,3-dihydroinden-1-one |
| SMILES | CCc1cnc(Nc2ccc(OC)cc2OC)nc1Oc1cccc2c1C(=O)CC2 |
| InChI | InChI=1S/C23H23N3O4/c1-4-14-13-24-23(25-17-10-9-16(28-2)12-20(17)29-3)26-22(14)30-19-7-5-6-15-8-11-18(27)21(15)19/h5-7,9-10,12-13H,4,8,11H2,1-3H3,(H,24,25,26) |
| InChIKey | CARQNELQFLFYAP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |