C9H16F3NO3 — CID 134308779
4,4,4-trifluoro-N,3-dihydroxy-2,3-dimethyl-2-propan-2-ylbutanamide (PubChem CID 134308779) has the molecular formula C9H16F3NO3 and a molecular weight of 243.22 g/mol. Its IUPAC name is 4,4,4-trifluoro-N,3-dihydroxy-2,3-dimethyl-2-propan-2-ylbutanamide.
| Compound Name | 4,4,4-trifluoro-N,3-dihydroxy-2,3-dimethyl-2-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 134308779 |
| Molecular Formula | C9H16F3NO3 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 4,4,4-trifluoro-N,3-dihydroxy-2,3-dimethyl-2-propan-2-ylbutanamide |
| SMILES | CC(C)C(C)(C(=O)NO)C(C)(O)C(F)(F)F |
| InChI | InChI=1S/C9H16F3NO3/c1-5(2)7(3,6(14)13-16)8(4,15)9(10,11)12/h5,15-16H,1-4H3,(H,13,14) |
| InChIKey | HARNLRSGLWPZJH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|