C6H8O8 — CID 134309574
3-formyloxy-2,3-dihydroxypentanedioic acid (PubChem CID 134309574) has the molecular formula C6H8O8 and a molecular weight of 208.12 g/mol. Its IUPAC name is 3-formyloxy-2,3-dihydroxypentanedioic acid.
| Compound Name | 3-formyloxy-2,3-dihydroxypentanedioic acid |
|---|---|
| PubChem CID | 134309574 |
| Molecular Formula | C6H8O8 |
| Molecular Weight | 208.12 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | 3-formyloxy-2,3-dihydroxypentanedioic acid |
| SMILES | O=COC(O)(CC(=O)O)C(O)C(=O)O |
| InChI | InChI=1S/C6H8O8/c7-2-14-6(13,1-3(8)9)4(10)5(11)12/h2,4,10,13H,1H2,(H,8,9)(H,11,12) |
| InChIKey | GTCNXDRBXHMPAN-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.12 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|