C30H32N2O3 — CID 134312213
[4-[3-amino-1-[4-ethenyl-3-[(Z)-prop-1-enyl]anilino]-1-oxopropan-2-yl]phenyl] 2-(3,5-dimethylphenyl)acetate (PubChem CID 134312213) has the molecular formula C30H32N2O3 and a molecular weight of 468.60 g/mol. Its IUPAC name is [4-[3-amino-1-[4-ethenyl-3-[(Z)-prop-1-enyl]anilino]-1-oxopropan-2-yl]phenyl] 2-(3,5-dimethylphenyl)acetate.
| Compound Name | [4-[3-amino-1-[4-ethenyl-3-[(Z)-prop-1-enyl]anilino]-1-oxopropan-2-yl]phenyl] 2-(3,5-dimethylphenyl)acetate |
|---|---|
| PubChem CID | 134312213 |
| Molecular Formula | C30H32N2O3 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | [4-[3-amino-1-[4-ethenyl-3-[(Z)-prop-1-enyl]anilino]-1-oxopropan-2-yl]phenyl] 2-(3,5-dimethylphenyl)acetate |
| SMILES | C=Cc1ccc(NC(=O)C(CN)c2ccc(OC(=O)Cc3cc(C)cc(C)c3)cc2)cc1/C=C\C |
| InChI | InChI=1S/C30H32N2O3/c1-5-7-25-18-26(11-8-23(25)6-2)32-30(34)28(19-31)24-9-12-27(13-10-24)35-29(33)17-22-15-20(3)14-21(4)16-22/h5-16,18,28H,2,17,19,31H2,1,3-4H3,(H,32,34)/b7-5- |
| InChIKey | DQQFZBUMMHQYIR-ALCCZGGFSA-N |
| XLogP | 5.81 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|