C28H34N2O3 — CID 134312237
[4-[3-amino-1-[4-ethenyl-3-[(Z)-prop-1-enyl]anilino]-1-oxopropan-2-yl]phenyl] 2-cyclohexylacetate (PubChem CID 134312237) has the molecular formula C28H34N2O3 and a molecular weight of 446.59 g/mol. Its IUPAC name is [4-[3-amino-1-[4-ethenyl-3-[(Z)-prop-1-enyl]anilino]-1-oxopropan-2-yl]phenyl] 2-cyclohexylacetate.
| Compound Name | [4-[3-amino-1-[4-ethenyl-3-[(Z)-prop-1-enyl]anilino]-1-oxopropan-2-yl]phenyl] 2-cyclohexylacetate |
|---|---|
| PubChem CID | 134312237 |
| Molecular Formula | C28H34N2O3 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | [4-[3-amino-1-[4-ethenyl-3-[(Z)-prop-1-enyl]anilino]-1-oxopropan-2-yl]phenyl] 2-cyclohexylacetate |
| SMILES | C=Cc1ccc(NC(=O)C(CN)c2ccc(OC(=O)CC3CCCCC3)cc2)cc1/C=C\C |
| InChI | InChI=1S/C28H34N2O3/c1-3-8-23-18-24(14-11-21(23)4-2)30-28(32)26(19-29)22-12-15-25(16-13-22)33-27(31)17-20-9-6-5-7-10-20/h3-4,8,11-16,18,20,26H,2,5-7,9-10,17,19,29H2,1H3,(H,30,32)/b8-3- |
| InChIKey | RWFZRQPKFNXSKF-BAQGIRSFSA-N |
| XLogP | 5.92 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|