C21H23NO4 — CID 147675278
[3-(3-carbamoylphenyl)-4-hydroxyphenyl] 2-cyclohexylacetate (PubChem CID 147675278) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is [3-(3-carbamoylphenyl)-4-hydroxyphenyl] 2-cyclohexylacetate.
| Compound Name | [3-(3-carbamoylphenyl)-4-hydroxyphenyl] 2-cyclohexylacetate |
|---|---|
| PubChem CID | 147675278 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | [3-(3-carbamoylphenyl)-4-hydroxyphenyl] 2-cyclohexylacetate |
| SMILES | NC(=O)c1cccc(-c2cc(OC(=O)CC3CCCCC3)ccc2O)c1 |
| InChI | InChI=1S/C21H23NO4/c22-21(25)16-8-4-7-15(12-16)18-13-17(9-10-19(18)23)26-20(24)11-14-5-2-1-3-6-14/h4,7-10,12-14,23H,1-3,5-6,11H2,(H2,22,25) |
| InChIKey | GOASDXDCPQPTFT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|