C19H32N2O5 — CID 134312366
tert-butyl 2-(5-formyloxan-2-yl)-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate (PubChem CID 134312366) has the molecular formula C19H32N2O5 and a molecular weight of 368.47 g/mol. Its IUPAC name is tert-butyl 2-(5-formyloxan-2-yl)-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate.
| Compound Name | tert-butyl 2-(5-formyloxan-2-yl)-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate |
|---|---|
| PubChem CID | 134312366 |
| Molecular Formula | C19H32N2O5 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | tert-butyl 2-(5-formyloxan-2-yl)-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CNCC(C1CCC(C=O)CO1)O2 |
| InChI | InChI=1S/C19H32N2O5/c1-18(2,3)26-17(23)21-8-6-19(7-9-21)13-20-10-16(25-19)15-5-4-14(11-22)12-24-15/h11,14-16,20H,4-10,12-13H2,1-3H3 |
| InChIKey | IBIRKDCDRYDLGO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|