C32H32N2 — CID 134315546
(2Z)-N-[(2E)-3,4-diphenylpenta-2,4-dien-2-yl]-3-(3-methanimidoyl-4-methylphenyl)-4-methylhexa-2,4,5-trien-2-amine (PubChem CID 134315546) has the molecular formula C32H32N2 and a molecular weight of 444.62 g/mol. Its IUPAC name is (2Z)-N-[(2E)-3,4-diphenylpenta-2,4-dien-2-yl]-3-(3-methanimidoyl-4-methylphenyl)-4-methylhexa-2,4,5-trien-2-amine.
| Compound Name | (2Z)-N-[(2E)-3,4-diphenylpenta-2,4-dien-2-yl]-3-(3-methanimidoyl-4-methylphenyl)-4-methylhexa-2,4,5-trien-2-amine |
|---|---|
| PubChem CID | 134315546 |
| Molecular Formula | C32H32N2 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | (2Z)-N-[(2E)-3,4-diphenylpenta-2,4-dien-2-yl]-3-(3-methanimidoyl-4-methylphenyl)-4-methylhexa-2,4,5-trien-2-amine |
| SMILES | [H]/N=C/c1cc(/C(C(C)=C=C)=C(\C)N/C(C)=C(/C(=C)c2ccccc2)c2ccccc2)ccc1C |
| InChI | InChI=1S/C32H32N2/c1-7-22(2)31(29-19-18-23(3)30(20-29)21-33)25(5)34-26(6)32(28-16-12-9-13-17-28)24(4)27-14-10-8-11-15-27/h8-21,33-34H,1,4H2,2-3,5-6H3/b31-25+,32-26-,33-21+ |
| InChIKey | QIZWCDAZHFBFLG-GMWQADJGSA-N |
| XLogP | 8.19 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|