C17H28N4O3 — CID 134316799
[3-[(3R)-3-(dimethylamino)piperidin-1-yl]-1-(1-ethylimidazol-2-yl)-3-oxopropyl] acetate (PubChem CID 134316799) has the molecular formula C17H28N4O3 and a molecular weight of 336.44 g/mol. Its IUPAC name is [3-[(3R)-3-(dimethylamino)piperidin-1-yl]-1-(1-ethylimidazol-2-yl)-3-oxopropyl] acetate.
| Compound Name | [3-[(3R)-3-(dimethylamino)piperidin-1-yl]-1-(1-ethylimidazol-2-yl)-3-oxopropyl] acetate |
|---|---|
| PubChem CID | 134316799 |
| Molecular Formula | C17H28N4O3 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | [3-[(3R)-3-(dimethylamino)piperidin-1-yl]-1-(1-ethylimidazol-2-yl)-3-oxopropyl] acetate |
| SMILES | CCn1ccnc1C(CC(=O)N1CCC[C@@H](N(C)C)C1)OC(C)=O |
| InChI | InChI=1S/C17H28N4O3/c1-5-20-10-8-18-17(20)15(24-13(2)22)11-16(23)21-9-6-7-14(12-21)19(3)4/h8,10,14-15H,5-7,9,11-12H2,1-4H3/t14-,15?/m1/s1 |
| InChIKey | BXZJJRMZPAVRSO-GICMACPYSA-N |
| XLogP | 1.45 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |