C48H50NO2PS — CID 134317324
5,11,17-tritert-butyl-22-(10-tert-butylanthracen-9-yl)-1-sulfanylidene-8,14-dioxa-22-aza-1λ5-phosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaene (PubChem CID 134317324) has the molecular formula C48H50NO2PS and a molecular weight of 735.97 g/mol. Its IUPAC name is 5,11,17-tritert-butyl-22-(10-tert-butylanthracen-9-yl)-1-sulfanylidene-8,14-dioxa-22-aza-1λ5-phosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaene.
| Compound Name | 5,11,17-tritert-butyl-22-(10-tert-butylanthracen-9-yl)-1-sulfanylidene-8,14-dioxa-22-aza-1λ5-phosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaene |
|---|---|
| PubChem CID | 134317324 |
| Molecular Formula | C48H50NO2PS |
| Molecular Weight | 735.97 g/mol |
| Exact Mass | 735.33 |
| IUPAC Name | 5,11,17-tritert-butyl-22-(10-tert-butylanthracen-9-yl)-1-sulfanylidene-8,14-dioxa-22-aza-1λ5-phosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaene |
| SMILES | CC(C)(C)c1cc2c3c(c1)Oc1cc(C(C)(C)C)cc4c1P3(=S)c1c(cc(C(C)(C)C)cc1N4c1c3ccccc3c(C(C)(C)C)c3ccccc13)O2 |
| InChI | InChI=1S/C48H50NO2PS/c1-45(2,3)27-21-34-42-36(23-27)50-38-25-29(47(7,8)9)26-39-44(38)52(42,53)43-35(22-28(46(4,5)6)24-37(43)51-39)49(34)41-32-19-15-13-17-30(32)40(48(10,11)12)31-18-14-16-20-33(31)41/h13-26H,1-12H3 |
| InChIKey | AQWHKSGHXWXBFW-UHFFFAOYSA-N |
| XLogP | 12.93 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.97 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|