C24H12Cl2NO2PS — CID 134317330
5,17-dichloro-22-phenyl-1-sulfanylidene-8,14-dioxa-22-aza-1λ5-phosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaene (PubChem CID 134317330) has the molecular formula C24H12Cl2NO2PS and a molecular weight of 480.31 g/mol. Its IUPAC name is 5,17-dichloro-22-phenyl-1-sulfanylidene-8,14-dioxa-22-aza-1λ5-phosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaene.
| Compound Name | 5,17-dichloro-22-phenyl-1-sulfanylidene-8,14-dioxa-22-aza-1λ5-phosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaene |
|---|---|
| PubChem CID | 134317330 |
| Molecular Formula | C24H12Cl2NO2PS |
| Molecular Weight | 480.31 g/mol |
| Exact Mass | 478.97 |
| IUPAC Name | 5,17-dichloro-22-phenyl-1-sulfanylidene-8,14-dioxa-22-aza-1λ5-phosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaene |
| SMILES | S=P12c3c4cccc3Oc3cc(Cl)cc(c31)N(c1ccccc1)c1cc(Cl)cc(c12)O4 |
| InChI | InChI=1S/C24H12Cl2NO2PS/c25-13-9-16-22-20(11-13)28-18-7-4-8-19-24(18)30(22,31)23-17(10-14(26)12-21(23)29-19)27(16)15-5-2-1-3-6-15/h1-12H |
| InChIKey | HTEUHHUGZZLASR-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.31 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|